C23H16F3N5O — CID 130315588
N-[3-[2-[4-(methylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]ethynyl]phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 130315588) has the molecular formula C23H16F3N5O and a molecular weight of 435.41 g/mol. Its IUPAC name is N-[3-[2-[4-(methylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]ethynyl]phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[2-[4-(methylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]ethynyl]phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 130315588 |
| Molecular Formula | C23H16F3N5O |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | N-[3-[2-[4-(methylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]ethynyl]phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | CNc1ncnc2[nH]cc(C#Cc3cccc(NC(=O)c4cccc(C(F)(F)F)c4)c3)c12 |
| InChI | InChI=1S/C23H16F3N5O/c1-27-20-19-16(12-28-21(19)30-13-29-20)9-8-14-4-2-7-18(10-14)31-22(32)15-5-3-6-17(11-15)23(24,25)26/h2-7,10-13H,1H3,(H,31,32)(H2,27,28,29,30) |
| InChIKey | VLFJEFGSMABASB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|