C25H18N6O2 — CID 69495007
N-[3-[4-(6-amino-7H-purin-8-yl)benzoyl]phenyl]benzamide (PubChem CID 69495007) has the molecular formula C25H18N6O2 and a molecular weight of 434.46 g/mol. Its IUPAC name is N-[3-[4-(6-amino-7H-purin-8-yl)benzoyl]phenyl]benzamide.
| Compound Name | N-[3-[4-(6-amino-7H-purin-8-yl)benzoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 69495007 |
| Molecular Formula | C25H18N6O2 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | N-[3-[4-(6-amino-7H-purin-8-yl)benzoyl]phenyl]benzamide |
| SMILES | Nc1ncnc2nc(-c3ccc(C(=O)c4cccc(NC(=O)c5ccccc5)c4)cc3)[nH]c12 |
| InChI | InChI=1S/C25H18N6O2/c26-22-20-24(28-14-27-22)31-23(30-20)16-11-9-15(10-12-16)21(32)18-7-4-8-19(13-18)29-25(33)17-5-2-1-3-6-17/h1-14H,(H,29,33)(H3,26,27,28,30,31) |
| InChIKey | GXJSKFVYWFEBTA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |