C15H15N7O2S — CID 4664940
N-(3-acetamidophenyl)-2-[(6-amino-7H-purin-8-yl)sulfanyl]acetamide (PubChem CID 4664940) has the molecular formula C15H15N7O2S and a molecular weight of 357.40 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-2-[(6-amino-7H-purin-8-yl)sulfanyl]acetamide.
| Compound Name | N-(3-acetamidophenyl)-2-[(6-amino-7H-purin-8-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 4664940 |
| Molecular Formula | C15H15N7O2S |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | N-(3-acetamidophenyl)-2-[(6-amino-7H-purin-8-yl)sulfanyl]acetamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)CSc2nc3ncnc(N)c3[nH]2)c1 |
| InChI | InChI=1S/C15H15N7O2S/c1-8(23)19-9-3-2-4-10(5-9)20-11(24)6-25-15-21-12-13(16)17-7-18-14(12)22-15/h2-5,7H,6H2,1H3,(H,19,23)(H,20,24)(H3,16,17,18,21,22) |
| InChIKey | ZGOQIHZATRBOEB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |