C17H20N6O3S — CID 5014230
2-[(6-amino-7H-purin-8-yl)sulfanyl]-N-(2,5-diethoxyphenyl)acetamide (PubChem CID 5014230) has the molecular formula C17H20N6O3S and a molecular weight of 388.45 g/mol. Its IUPAC name is 2-[(6-amino-7H-purin-8-yl)sulfanyl]-N-(2,5-diethoxyphenyl)acetamide.
| Compound Name | 2-[(6-amino-7H-purin-8-yl)sulfanyl]-N-(2,5-diethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 5014230 |
| Molecular Formula | C17H20N6O3S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 2-[(6-amino-7H-purin-8-yl)sulfanyl]-N-(2,5-diethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)CSc2nc3ncnc(N)c3[nH]2)c1 |
| InChI | InChI=1S/C17H20N6O3S/c1-3-25-10-5-6-12(26-4-2)11(7-10)21-13(24)8-27-17-22-14-15(18)19-9-20-16(14)23-17/h5-7,9H,3-4,8H2,1-2H3,(H,21,24)(H3,18,19,20,22,23) |
| InChIKey | IFQZUHIKQYQJSJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 128.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |