C15H16N6OS — CID 858560
2-[(6-amino-7H-purin-8-yl)sulfanyl]-N-(2,4-dimethylphenyl)acetamide (PubChem CID 858560) has the molecular formula C15H16N6OS and a molecular weight of 328.40 g/mol. Its IUPAC name is 2-[(6-amino-7H-purin-8-yl)sulfanyl]-N-(2,4-dimethylphenyl)acetamide.
| Compound Name | 2-[(6-amino-7H-purin-8-yl)sulfanyl]-N-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 858560 |
| Molecular Formula | C15H16N6OS |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-[(6-amino-7H-purin-8-yl)sulfanyl]-N-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CSc2nc3ncnc(N)c3[nH]2)c(C)c1 |
| InChI | InChI=1S/C15H16N6OS/c1-8-3-4-10(9(2)5-8)19-11(22)6-23-15-20-12-13(16)17-7-18-14(12)21-15/h3-5,7H,6H2,1-2H3,(H,19,22)(H3,16,17,18,20,21) |
| InChIKey | YMWADTNFYPZCJW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |