C14H13ClN6O2S — CID 1468356
2-[(6-amino-7H-purin-8-yl)sulfanyl]-N-(5-chloro-2-methoxyphenyl)acetamide (PubChem CID 1468356) has the molecular formula C14H13ClN6O2S and a molecular weight of 364.82 g/mol. Its IUPAC name is 2-[(6-amino-7H-purin-8-yl)sulfanyl]-N-(5-chloro-2-methoxyphenyl)acetamide.
| Compound Name | 2-[(6-amino-7H-purin-8-yl)sulfanyl]-N-(5-chloro-2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 1468356 |
| Molecular Formula | C14H13ClN6O2S |
| Molecular Weight | 364.82 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 2-[(6-amino-7H-purin-8-yl)sulfanyl]-N-(5-chloro-2-methoxyphenyl)acetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CSc1nc2ncnc(N)c2[nH]1 |
| InChI | InChI=1S/C14H13ClN6O2S/c1-23-9-3-2-7(15)4-8(9)19-10(22)5-24-14-20-11-12(16)17-6-18-13(11)21-14/h2-4,6H,5H2,1H3,(H,19,22)(H3,16,17,18,20,21) |
| InChIKey | OSEVDTROTRPONH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.82 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |