C16H17N7O2S — CID 3365716
N-[4-[[2-[(6-amino-7H-purin-8-yl)sulfanyl]acetyl]amino]phenyl]propanamide (PubChem CID 3365716) has the molecular formula C16H17N7O2S and a molecular weight of 371.43 g/mol. Its IUPAC name is N-[4-[[2-[(6-amino-7H-purin-8-yl)sulfanyl]acetyl]amino]phenyl]propanamide.
| Compound Name | N-[4-[[2-[(6-amino-7H-purin-8-yl)sulfanyl]acetyl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 3365716 |
| Molecular Formula | C16H17N7O2S |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | N-[4-[[2-[(6-amino-7H-purin-8-yl)sulfanyl]acetyl]amino]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(NC(=O)CSc2nc3ncnc(N)c3[nH]2)cc1 |
| InChI | InChI=1S/C16H17N7O2S/c1-2-11(24)20-9-3-5-10(6-4-9)21-12(25)7-26-16-22-13-14(17)18-8-19-15(13)23-16/h3-6,8H,2,7H2,1H3,(H,20,24)(H,21,25)(H3,17,18,19,22,23) |
| InChIKey | NBLCIWBSEOSVFG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |