C14H11F3N6OS — CID 24793625
2-[(6-amino-7H-purin-8-yl)sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 24793625) has the molecular formula C14H11F3N6OS and a molecular weight of 368.34 g/mol. Its IUPAC name is 2-[(6-amino-7H-purin-8-yl)sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(6-amino-7H-purin-8-yl)sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 24793625 |
| Molecular Formula | C14H11F3N6OS |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 2-[(6-amino-7H-purin-8-yl)sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | Nc1ncnc2nc(SCC(=O)Nc3cccc(C(F)(F)F)c3)[nH]c12 |
| InChI | InChI=1S/C14H11F3N6OS/c15-14(16,17)7-2-1-3-8(4-7)21-9(24)5-25-13-22-10-11(18)19-6-20-12(10)23-13/h1-4,6H,5H2,(H,21,24)(H3,18,19,20,22,23) |
| InChIKey | DMAYGYDVQJSORM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |