C14H10ClF3N4O2S — CID 11486117
2-(2-amino-6-chloro-5-formylpyrimidin-4-yl)sulfanyl-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 11486117) has the molecular formula C14H10ClF3N4O2S and a molecular weight of 390.77 g/mol. Its IUPAC name is 2-(2-amino-6-chloro-5-formylpyrimidin-4-yl)sulfanyl-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(2-amino-6-chloro-5-formylpyrimidin-4-yl)sulfanyl-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 11486117 |
| Molecular Formula | C14H10ClF3N4O2S |
| Molecular Weight | 390.77 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 2-(2-amino-6-chloro-5-formylpyrimidin-4-yl)sulfanyl-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | Nc1nc(Cl)c(C=O)c(SCC(=O)Nc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C14H10ClF3N4O2S/c15-11-9(5-23)12(22-13(19)21-11)25-6-10(24)20-8-3-1-2-7(4-8)14(16,17)18/h1-5H,6H2,(H,20,24)(H2,19,21,22) |
| InChIKey | LRMVFPSICRIEPF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.77 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|