C19H17F3N2O2 — CID 24535194
N-cyclopropyl-3-[[2-[4-(trifluoromethyl)phenyl]acetyl]amino]benzamide (PubChem CID 24535194) has the molecular formula C19H17F3N2O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is N-cyclopropyl-3-[[2-[4-(trifluoromethyl)phenyl]acetyl]amino]benzamide.
| Compound Name | N-cyclopropyl-3-[[2-[4-(trifluoromethyl)phenyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 24535194 |
| Molecular Formula | C19H17F3N2O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-cyclopropyl-3-[[2-[4-(trifluoromethyl)phenyl]acetyl]amino]benzamide |
| SMILES | O=C(Cc1ccc(C(F)(F)F)cc1)Nc1cccc(C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C19H17F3N2O2/c20-19(21,22)14-6-4-12(5-7-14)10-17(25)23-16-3-1-2-13(11-16)18(26)24-15-8-9-15/h1-7,11,15H,8-10H2,(H,23,25)(H,24,26) |
| InChIKey | MIPSAUNPNZZDQF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |