C20H22N2O2 — CID 18121849
N-cyclopropyl-3-[3-(4-methylphenyl)propanoylamino]benzamide (PubChem CID 18121849) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-cyclopropyl-3-[3-(4-methylphenyl)propanoylamino]benzamide.
| Compound Name | N-cyclopropyl-3-[3-(4-methylphenyl)propanoylamino]benzamide |
|---|---|
| PubChem CID | 18121849 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | N-cyclopropyl-3-[3-(4-methylphenyl)propanoylamino]benzamide |
| SMILES | Cc1ccc(CCC(=O)Nc2cccc(C(=O)NC3CC3)c2)cc1 |
| InChI | InChI=1S/C20H22N2O2/c1-14-5-7-15(8-6-14)9-12-19(23)21-18-4-2-3-16(13-18)20(24)22-17-10-11-17/h2-8,13,17H,9-12H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | HEAAJBYAZSCUBN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |