C19H18F3N3O2 — CID 60527760
3-(cyclopropylcarbamoylamino)-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 60527760) has the molecular formula C19H18F3N3O2 and a molecular weight of 377.37 g/mol. Its IUPAC name is 3-(cyclopropylcarbamoylamino)-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 3-(cyclopropylcarbamoylamino)-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 60527760 |
| Molecular Formula | C19H18F3N3O2 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 3-(cyclopropylcarbamoylamino)-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | O=C(Nc1cccc(C(=O)NCc2ccc(C(F)(F)F)cc2)c1)NC1CC1 |
| InChI | InChI=1S/C19H18F3N3O2/c20-19(21,22)14-6-4-12(5-7-14)11-23-17(26)13-2-1-3-16(10-13)25-18(27)24-15-8-9-15/h1-7,10,15H,8-9,11H2,(H,23,26)(H2,24,25,27) |
| InChIKey | NVGWLTQHKWJVSB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |