C19H19F3N4O2 — CID 120604765
N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-3-(cyclopropylcarbamoylamino)benzamide (PubChem CID 120604765) has the molecular formula C19H19F3N4O2 and a molecular weight of 392.38 g/mol. Its IUPAC name is N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-3-(cyclopropylcarbamoylamino)benzamide.
| Compound Name | N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-3-(cyclopropylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 120604765 |
| Molecular Formula | C19H19F3N4O2 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-3-(cyclopropylcarbamoylamino)benzamide |
| SMILES | NCc1cc(NC(=O)c2cccc(NC(=O)NC3CC3)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H19F3N4O2/c20-19(21,22)13-6-11(10-23)7-16(9-13)24-17(27)12-2-1-3-15(8-12)26-18(28)25-14-4-5-14/h1-3,6-9,14H,4-5,10,23H2,(H,24,27)(H2,25,26,28) |
| InChIKey | BWUIWLDVLMLNDQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |