C23H15F3N6O — CID 44569901
1-(3-cyanophenyl)-3-[4-[3-(trifluoromethyl)anilino]quinazolin-6-yl]urea (PubChem CID 44569901) has the molecular formula C23H15F3N6O and a molecular weight of 448.41 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-[4-[3-(trifluoromethyl)anilino]quinazolin-6-yl]urea.
| Compound Name | 1-(3-cyanophenyl)-3-[4-[3-(trifluoromethyl)anilino]quinazolin-6-yl]urea |
|---|---|
| PubChem CID | 44569901 |
| Molecular Formula | C23H15F3N6O |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 1-(3-cyanophenyl)-3-[4-[3-(trifluoromethyl)anilino]quinazolin-6-yl]urea |
| SMILES | N#Cc1cccc(NC(=O)Nc2ccc3ncnc(Nc4cccc(C(F)(F)F)c4)c3c2)c1 |
| InChI | InChI=1S/C23H15F3N6O/c24-23(25,26)15-4-2-6-17(10-15)30-21-19-11-18(7-8-20(19)28-13-29-21)32-22(33)31-16-5-1-3-14(9-16)12-27/h1-11,13H,(H,28,29,30)(H2,31,32,33) |
| InChIKey | OYZBKZLEVMAUDE-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |