C20H14F3N5O — CID 109337788
2-(3-cyanoanilino)-6-methyl-N-[3-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide (PubChem CID 109337788) has the molecular formula C20H14F3N5O and a molecular weight of 397.36 g/mol. Its IUPAC name is 2-(3-cyanoanilino)-6-methyl-N-[3-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide.
| Compound Name | 2-(3-cyanoanilino)-6-methyl-N-[3-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109337788 |
| Molecular Formula | C20H14F3N5O |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 2-(3-cyanoanilino)-6-methyl-N-[3-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cccc(C(F)(F)F)c2)nc(Nc2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C20H14F3N5O/c1-12-8-17(18(29)26-16-7-3-5-14(10-16)20(21,22)23)28-19(25-12)27-15-6-2-4-13(9-15)11-24/h2-10H,1H3,(H,26,29)(H,25,27,28) |
| InChIKey | UCGYNBCQVUMHEU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |