C23H23N5O — CID 109336643
2-(3-cyanoanilino)-N-(2,6-diethylphenyl)-6-methylpyrimidine-4-carboxamide (PubChem CID 109336643) has the molecular formula C23H23N5O and a molecular weight of 385.47 g/mol. Its IUPAC name is 2-(3-cyanoanilino)-N-(2,6-diethylphenyl)-6-methylpyrimidine-4-carboxamide.
| Compound Name | 2-(3-cyanoanilino)-N-(2,6-diethylphenyl)-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109336643 |
| Molecular Formula | C23H23N5O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 2-(3-cyanoanilino)-N-(2,6-diethylphenyl)-6-methylpyrimidine-4-carboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)c1cc(C)nc(Nc2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C23H23N5O/c1-4-17-9-7-10-18(5-2)21(17)28-22(29)20-12-15(3)25-23(27-20)26-19-11-6-8-16(13-19)14-24/h6-13H,4-5H2,1-3H3,(H,28,29)(H,25,26,27) |
| InChIKey | SATURINJVSPKNC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |