C23H23N5O — CID 109336635
N-(2-cyanophenyl)-2-(2,6-diethylanilino)-6-methylpyrimidine-4-carboxamide (PubChem CID 109336635) has the molecular formula C23H23N5O and a molecular weight of 385.47 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2-(2,6-diethylanilino)-6-methylpyrimidine-4-carboxamide.
| Compound Name | N-(2-cyanophenyl)-2-(2,6-diethylanilino)-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109336635 |
| Molecular Formula | C23H23N5O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-(2-cyanophenyl)-2-(2,6-diethylanilino)-6-methylpyrimidine-4-carboxamide |
| SMILES | CCc1cccc(CC)c1Nc1nc(C)cc(C(=O)Nc2ccccc2C#N)n1 |
| InChI | InChI=1S/C23H23N5O/c1-4-16-10-8-11-17(5-2)21(16)28-23-25-15(3)13-20(27-23)22(29)26-19-12-7-6-9-18(19)14-24/h6-13H,4-5H2,1-3H3,(H,26,29)(H,25,27,28) |
| InChIKey | RFHWAZGDMHOZOF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |