C20H14N6O — CID 109338178
2-(2-cyanoanilino)-N-(2-cyanophenyl)-6-methylpyrimidine-4-carboxamide (PubChem CID 109338178) has the molecular formula C20H14N6O and a molecular weight of 354.37 g/mol. Its IUPAC name is 2-(2-cyanoanilino)-N-(2-cyanophenyl)-6-methylpyrimidine-4-carboxamide.
| Compound Name | 2-(2-cyanoanilino)-N-(2-cyanophenyl)-6-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109338178 |
| Molecular Formula | C20H14N6O |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-(2-cyanoanilino)-N-(2-cyanophenyl)-6-methylpyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccccc2C#N)nc(Nc2ccccc2C#N)n1 |
| InChI | InChI=1S/C20H14N6O/c1-13-10-18(19(27)24-16-8-4-2-6-14(16)11-21)26-20(23-13)25-17-9-5-3-7-15(17)12-22/h2-10H,1H3,(H,24,27)(H,23,25,26) |
| InChIKey | MTWISMYICRNKRY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |