C19H23N5O — CID 109334286
2-(3-cyanoanilino)-6-methyl-N,N-dipropylpyrimidine-4-carboxamide (PubChem CID 109334286) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is 2-(3-cyanoanilino)-6-methyl-N,N-dipropylpyrimidine-4-carboxamide.
| Compound Name | 2-(3-cyanoanilino)-6-methyl-N,N-dipropylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109334286 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 2-(3-cyanoanilino)-6-methyl-N,N-dipropylpyrimidine-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)nc(Nc2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C19H23N5O/c1-4-9-24(10-5-2)18(25)17-11-14(3)21-19(23-17)22-16-8-6-7-15(12-16)13-20/h6-8,11-12H,4-5,9-10H2,1-3H3,(H,21,22,23) |
| InChIKey | LFCWRFCEQWZCBE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |