C17H17N5O2 — CID 109324521
3-[[4-methyl-6-(morpholine-4-carbonyl)pyrimidin-2-yl]amino]benzonitrile (PubChem CID 109324521) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is 3-[[4-methyl-6-(morpholine-4-carbonyl)pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 3-[[4-methyl-6-(morpholine-4-carbonyl)pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 109324521 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 3-[[4-methyl-6-(morpholine-4-carbonyl)pyrimidin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(C(=O)N2CCOCC2)nc(Nc2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C17H17N5O2/c1-12-9-15(16(23)22-5-7-24-8-6-22)21-17(19-12)20-14-4-2-3-13(10-14)11-18/h2-4,9-10H,5-8H2,1H3,(H,19,20,21) |
| InChIKey | ZILPLKMQJQJAOF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |