C21H14N4OS — CID 155806956
N-[4-(3-ethynylanilino)quinazolin-6-yl]thiophene-2-carboxamide (PubChem CID 155806956) has the molecular formula C21H14N4OS and a molecular weight of 370.44 g/mol. Its IUPAC name is N-[4-(3-ethynylanilino)quinazolin-6-yl]thiophene-2-carboxamide.
| Compound Name | N-[4-(3-ethynylanilino)quinazolin-6-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 155806956 |
| Molecular Formula | C21H14N4OS |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N-[4-(3-ethynylanilino)quinazolin-6-yl]thiophene-2-carboxamide |
| SMILES | C#Cc1cccc(Nc2ncnc3ccc(NC(=O)c4cccs4)cc23)c1 |
| InChI | InChI=1S/C21H14N4OS/c1-2-14-5-3-6-15(11-14)24-20-17-12-16(8-9-18(17)22-13-23-20)25-21(26)19-7-4-10-27-19/h1,3-13H,(H,25,26)(H,22,23,24) |
| InChIKey | JCMBOVCGUSWQGD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|