C19H16N4O3 — CID 24945016
3-[4-(3-ethynylanilino)quinazolin-6-yl]oxy-N-hydroxypropanamide (PubChem CID 24945016) has the molecular formula C19H16N4O3 and a molecular weight of 348.36 g/mol. Its IUPAC name is 3-[4-(3-ethynylanilino)quinazolin-6-yl]oxy-N-hydroxypropanamide.
| Compound Name | 3-[4-(3-ethynylanilino)quinazolin-6-yl]oxy-N-hydroxypropanamide |
|---|---|
| PubChem CID | 24945016 |
| Molecular Formula | C19H16N4O3 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 3-[4-(3-ethynylanilino)quinazolin-6-yl]oxy-N-hydroxypropanamide |
| SMILES | C#Cc1cccc(Nc2ncnc3ccc(OCCC(=O)NO)cc23)c1 |
| InChI | InChI=1S/C19H16N4O3/c1-2-13-4-3-5-14(10-13)22-19-16-11-15(26-9-8-18(24)23-25)6-7-17(16)20-12-21-19/h1,3-7,10-12,25H,8-9H2,(H,23,24)(H,20,21,22) |
| InChIKey | VPZVDMXTKVKPNF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|