C25H28N6O — CID 59142799
N-[4-(3-ethynylanilino)quinazolin-6-yl]-2-methyl-2-(4-methylpiperazin-1-yl)propanamide (PubChem CID 59142799) has the molecular formula C25H28N6O and a molecular weight of 428.54 g/mol. Its IUPAC name is N-[4-(3-ethynylanilino)quinazolin-6-yl]-2-methyl-2-(4-methylpiperazin-1-yl)propanamide.
| Compound Name | N-[4-(3-ethynylanilino)quinazolin-6-yl]-2-methyl-2-(4-methylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 59142799 |
| Molecular Formula | C25H28N6O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | N-[4-(3-ethynylanilino)quinazolin-6-yl]-2-methyl-2-(4-methylpiperazin-1-yl)propanamide |
| SMILES | C#Cc1cccc(Nc2ncnc3ccc(NC(=O)C(C)(C)N4CCN(C)CC4)cc23)c1 |
| InChI | InChI=1S/C25H28N6O/c1-5-18-7-6-8-19(15-18)28-23-21-16-20(9-10-22(21)26-17-27-23)29-24(32)25(2,3)31-13-11-30(4)12-14-31/h1,6-10,15-17H,11-14H2,2-4H3,(H,29,32)(H,26,27,28) |
| InChIKey | DMSXQNTZLBISJC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|