C29H36N6O — CID 44599638
N-[4-(3-ethynylanilino)quinazolin-6-yl]-2-(4-heptan-4-ylpiperazin-1-yl)acetamide (PubChem CID 44599638) has the molecular formula C29H36N6O and a molecular weight of 484.65 g/mol. Its IUPAC name is N-[4-(3-ethynylanilino)quinazolin-6-yl]-2-(4-heptan-4-ylpiperazin-1-yl)acetamide.
| Compound Name | N-[4-(3-ethynylanilino)quinazolin-6-yl]-2-(4-heptan-4-ylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 44599638 |
| Molecular Formula | C29H36N6O |
| Molecular Weight | 484.65 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | N-[4-(3-ethynylanilino)quinazolin-6-yl]-2-(4-heptan-4-ylpiperazin-1-yl)acetamide |
| SMILES | C#Cc1cccc(Nc2ncnc3ccc(NC(=O)CN4CCN(C(CCC)CCC)CC4)cc23)c1 |
| InChI | InChI=1S/C29H36N6O/c1-4-8-25(9-5-2)35-16-14-34(15-17-35)20-28(36)32-24-12-13-27-26(19-24)29(31-21-30-27)33-23-11-7-10-22(6-3)18-23/h3,7,10-13,18-19,21,25H,4-5,8-9,14-17,20H2,1-2H3,(H,32,36)(H,30,31,33) |
| InChIKey | JFCCEKQARDDEJU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.65 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|