C26H29N5O — CID 157095646
1-[4-(3-ethynylanilino)quinazolin-6-yl]-3-(4-propan-2-ylpiperazin-1-yl)propan-2-one (PubChem CID 157095646) has the molecular formula C26H29N5O and a molecular weight of 427.55 g/mol. Its IUPAC name is 1-[4-(3-ethynylanilino)quinazolin-6-yl]-3-(4-propan-2-ylpiperazin-1-yl)propan-2-one.
| Compound Name | 1-[4-(3-ethynylanilino)quinazolin-6-yl]-3-(4-propan-2-ylpiperazin-1-yl)propan-2-one |
|---|---|
| PubChem CID | 157095646 |
| Molecular Formula | C26H29N5O |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 1-[4-(3-ethynylanilino)quinazolin-6-yl]-3-(4-propan-2-ylpiperazin-1-yl)propan-2-one |
| SMILES | C#Cc1cccc(Nc2ncnc3ccc(CC(=O)CN4CCN(C(C)C)CC4)cc23)c1 |
| InChI | InChI=1S/C26H29N5O/c1-4-20-6-5-7-22(14-20)29-26-24-16-21(8-9-25(24)27-18-28-26)15-23(32)17-30-10-12-31(13-11-30)19(2)3/h1,5-9,14,16,18-19H,10-13,15,17H2,2-3H3,(H,27,28,29) |
| InChIKey | OJAGRINRWYGJLF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|