C26H19F2N3O — CID 160515348
4-(2,4-difluorophenyl)-1-[4-(3-ethynylanilino)quinazolin-6-yl]butan-2-one (PubChem CID 160515348) has the molecular formula C26H19F2N3O and a molecular weight of 427.45 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-1-[4-(3-ethynylanilino)quinazolin-6-yl]butan-2-one.
| Compound Name | 4-(2,4-difluorophenyl)-1-[4-(3-ethynylanilino)quinazolin-6-yl]butan-2-one |
|---|---|
| PubChem CID | 160515348 |
| Molecular Formula | C26H19F2N3O |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 4-(2,4-difluorophenyl)-1-[4-(3-ethynylanilino)quinazolin-6-yl]butan-2-one |
| SMILES | C#Cc1cccc(Nc2ncnc3ccc(CC(=O)CCc4ccc(F)cc4F)cc23)c1 |
| InChI | InChI=1S/C26H19F2N3O/c1-2-17-4-3-5-21(12-17)31-26-23-14-18(6-11-25(23)29-16-30-26)13-22(32)10-8-19-7-9-20(27)15-24(19)28/h1,3-7,9,11-12,14-16H,8,10,13H2,(H,29,30,31) |
| InChIKey | KEKBFOIGCPUHHV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|