C24H25N5O — CID 157095642
1-[4-(3-ethynylanilino)quinazolin-6-yl]-3-(4-methylpiperazin-1-yl)propan-2-one (PubChem CID 157095642) has the molecular formula C24H25N5O and a molecular weight of 399.50 g/mol. Its IUPAC name is 1-[4-(3-ethynylanilino)quinazolin-6-yl]-3-(4-methylpiperazin-1-yl)propan-2-one.
| Compound Name | 1-[4-(3-ethynylanilino)quinazolin-6-yl]-3-(4-methylpiperazin-1-yl)propan-2-one |
|---|---|
| PubChem CID | 157095642 |
| Molecular Formula | C24H25N5O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 1-[4-(3-ethynylanilino)quinazolin-6-yl]-3-(4-methylpiperazin-1-yl)propan-2-one |
| SMILES | C#Cc1cccc(Nc2ncnc3ccc(CC(=O)CN4CCN(C)CC4)cc23)c1 |
| InChI | InChI=1S/C24H25N5O/c1-3-18-5-4-6-20(13-18)27-24-22-15-19(7-8-23(22)25-17-26-24)14-21(30)16-29-11-9-28(2)10-12-29/h1,4-8,13,15,17H,9-12,14,16H2,2H3,(H,25,26,27) |
| InChIKey | QDQWYNBGWAGFNY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|