C18H21N5O — CID 22541503
4-(2-tert-butylhydrazinyl)-6-naphthalen-1-yloxypyrimidin-5-amine (PubChem CID 22541503) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 4-(2-tert-butylhydrazinyl)-6-naphthalen-1-yloxypyrimidin-5-amine.
| Compound Name | 4-(2-tert-butylhydrazinyl)-6-naphthalen-1-yloxypyrimidin-5-amine |
|---|---|
| PubChem CID | 22541503 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 4-(2-tert-butylhydrazinyl)-6-naphthalen-1-yloxypyrimidin-5-amine |
| SMILES | CC(C)(C)NNc1ncnc(Oc2cccc3ccccc23)c1N |
| InChI | InChI=1S/C18H21N5O/c1-18(2,3)23-22-16-15(19)17(21-11-20-16)24-14-10-6-8-12-7-4-5-9-13(12)14/h4-11,23H,19H2,1-3H3,(H,20,21,22) |
| InChIKey | LTCCIAHSNHGWIT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|