C25H27FN6O — CID 144620402
3-[[[6-amino-5-(2-fluoroethanimidoyl)pyrimidin-4-yl]amino]methyl]-8-methyl-2-phenylisoquinolin-1-one;ethane (PubChem CID 144620402) has the molecular formula C25H27FN6O and a molecular weight of 446.53 g/mol. Its IUPAC name is 3-[[[6-amino-5-(2-fluoroethanimidoyl)pyrimidin-4-yl]amino]methyl]-8-methyl-2-phenylisoquinolin-1-one;ethane.
| Compound Name | 3-[[[6-amino-5-(2-fluoroethanimidoyl)pyrimidin-4-yl]amino]methyl]-8-methyl-2-phenylisoquinolin-1-one;ethane |
|---|---|
| PubChem CID | 144620402 |
| Molecular Formula | C25H27FN6O |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 3-[[[6-amino-5-(2-fluoroethanimidoyl)pyrimidin-4-yl]amino]methyl]-8-methyl-2-phenylisoquinolin-1-one;ethane |
| SMILES | CC.[H]/N=C(\CF)c1c(N)ncnc1NCc1cc2cccc(C)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C23H21FN6O.C2H6/c1-14-6-5-7-15-10-17(30(23(31)19(14)15)16-8-3-2-4-9-16)12-27-22-20(18(25)11-24)21(26)28-13-29-22;1-2/h2-10,13,25H,11-12H2,1H3,(H3,26,27,28,29);1-2H3/b25-18+; |
| InChIKey | DBXJIUGQNWVCBP-LHSXHHQOSA-N |
| XLogP | 4.65 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|