C28H23FN6O — CID 126756134
3-[[[6-amino-5-(3-fluorobenzenecarboximidoyl)pyrimidin-4-yl]amino]methyl]-2-(2-methylphenyl)isoquinolin-1-one (PubChem CID 126756134) has the molecular formula C28H23FN6O and a molecular weight of 478.53 g/mol. Its IUPAC name is 3-[[[6-amino-5-(3-fluorobenzenecarboximidoyl)pyrimidin-4-yl]amino]methyl]-2-(2-methylphenyl)isoquinolin-1-one.
| Compound Name | 3-[[[6-amino-5-(3-fluorobenzenecarboximidoyl)pyrimidin-4-yl]amino]methyl]-2-(2-methylphenyl)isoquinolin-1-one |
|---|---|
| PubChem CID | 126756134 |
| Molecular Formula | C28H23FN6O |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 3-[[[6-amino-5-(3-fluorobenzenecarboximidoyl)pyrimidin-4-yl]amino]methyl]-2-(2-methylphenyl)isoquinolin-1-one |
| SMILES | [H]/N=C(\c1cccc(F)c1)c1c(N)ncnc1NCc1cc2ccccc2c(=O)n1-c1ccccc1C |
| InChI | InChI=1S/C28H23FN6O/c1-17-7-2-5-12-23(17)35-21(14-18-8-3-4-11-22(18)28(35)36)15-32-27-24(26(31)33-16-34-27)25(30)19-9-6-10-20(29)13-19/h2-14,16,30H,15H2,1H3,(H3,31,32,33,34)/b30-25+ |
| InChIKey | YIMFAFWLPIVLFE-QCWLDUFUSA-N |
| XLogP | 4.84 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|