C22H18F2N6O — CID 126756112
3-[[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]methyl]-8-fluoro-2-(2-fluorophenyl)isoquinolin-1-one (PubChem CID 126756112) has the molecular formula C22H18F2N6O and a molecular weight of 420.42 g/mol. Its IUPAC name is 3-[[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]methyl]-8-fluoro-2-(2-fluorophenyl)isoquinolin-1-one.
| Compound Name | 3-[[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]methyl]-8-fluoro-2-(2-fluorophenyl)isoquinolin-1-one |
|---|---|
| PubChem CID | 126756112 |
| Molecular Formula | C22H18F2N6O |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 3-[[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]methyl]-8-fluoro-2-(2-fluorophenyl)isoquinolin-1-one |
| SMILES | [H]/N=C(\C)c1c(N)ncnc1NCc1cc2cccc(F)c2c(=O)n1-c1ccccc1F |
| InChI | InChI=1S/C22H18F2N6O/c1-12(25)18-20(26)28-11-29-21(18)27-10-14-9-13-5-4-7-16(24)19(13)22(31)30(14)17-8-3-2-6-15(17)23/h2-9,11,25H,10H2,1H3,(H3,26,27,28,29)/b25-12+ |
| InChIKey | IBRJNRVPMRTAOE-BRJLIKDPSA-N |
| XLogP | 3.64 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|