C21H25ClN6O — CID 144752622
3-[[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]methyl]-8-chloro-2-cyclopropylisoquinolin-1-one;ethane (PubChem CID 144752622) has the molecular formula C21H25ClN6O and a molecular weight of 412.93 g/mol. Its IUPAC name is 3-[[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]methyl]-8-chloro-2-cyclopropylisoquinolin-1-one;ethane.
| Compound Name | 3-[[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]methyl]-8-chloro-2-cyclopropylisoquinolin-1-one;ethane |
|---|---|
| PubChem CID | 144752622 |
| Molecular Formula | C21H25ClN6O |
| Molecular Weight | 412.93 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 3-[[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]methyl]-8-chloro-2-cyclopropylisoquinolin-1-one;ethane |
| SMILES | CC.[H]/N=C(\C)c1c(N)ncnc1NCc1cc2cccc(Cl)c2c(=O)n1C1CC1 |
| InChI | InChI=1S/C19H19ClN6O.C2H6/c1-10(21)15-17(22)24-9-25-18(15)23-8-13-7-11-3-2-4-14(20)16(11)19(27)26(13)12-5-6-12;1-2/h2-4,7,9,12,21H,5-6,8H2,1H3,(H3,22,23,24,25);1-2H3/b21-10+; |
| InChIKey | VCGQNYUIMIEEBV-FYEZMLSJSA-N |
| XLogP | 4.39 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.93 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|