C20H24N6O — CID 144620455
3-[[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]methyl]-8-methyl-2-propan-2-ylisoquinolin-1-one (PubChem CID 144620455) has the molecular formula C20H24N6O and a molecular weight of 364.45 g/mol. Its IUPAC name is 3-[[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]methyl]-8-methyl-2-propan-2-ylisoquinolin-1-one.
| Compound Name | 3-[[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]methyl]-8-methyl-2-propan-2-ylisoquinolin-1-one |
|---|---|
| PubChem CID | 144620455 |
| Molecular Formula | C20H24N6O |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 3-[[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]methyl]-8-methyl-2-propan-2-ylisoquinolin-1-one |
| SMILES | [H]/N=C(\C)c1c(N)ncnc1NCc1cc2cccc(C)c2c(=O)n1C(C)C |
| InChI | InChI=1S/C20H24N6O/c1-11(2)26-15(8-14-7-5-6-12(3)16(14)20(26)27)9-23-19-17(13(4)21)18(22)24-10-25-19/h5-8,10-11,21H,9H2,1-4H3,(H3,22,23,24,25)/b21-13+ |
| InChIKey | JQUZCFQPQXXFSN-FYJGNVAPSA-N |
| XLogP | 3.26 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|