C26H26IN5O — CID 138659211
4-methyl-6-[[8-methyl-1-oxo-2-(2-propan-2-ylphenyl)isoquinolin-3-yl]methylamino]pyrimidine-5-carboximidoyl iodide (PubChem CID 138659211) has the molecular formula C26H26IN5O and a molecular weight of 551.43 g/mol. Its IUPAC name is 4-methyl-6-[[8-methyl-1-oxo-2-(2-propan-2-ylphenyl)isoquinolin-3-yl]methylamino]pyrimidine-5-carboximidoyl iodide.
| Compound Name | 4-methyl-6-[[8-methyl-1-oxo-2-(2-propan-2-ylphenyl)isoquinolin-3-yl]methylamino]pyrimidine-5-carboximidoyl iodide |
|---|---|
| PubChem CID | 138659211 |
| Molecular Formula | C26H26IN5O |
| Molecular Weight | 551.43 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | 4-methyl-6-[[8-methyl-1-oxo-2-(2-propan-2-ylphenyl)isoquinolin-3-yl]methylamino]pyrimidine-5-carboximidoyl iodide |
| SMILES | [H]/N=C(\I)c1c(C)ncnc1NCc1cc2cccc(C)c2c(=O)n1-c1ccccc1C(C)C |
| InChI | InChI=1S/C26H26IN5O/c1-15(2)20-10-5-6-11-21(20)32-19(12-18-9-7-8-16(3)22(18)26(32)33)13-29-25-23(24(27)28)17(4)30-14-31-25/h5-12,14-15,28H,13H2,1-4H3,(H,29,30,31)/b28-24- |
| InChIKey | KZPWRGSGAFCRIQ-COOPMVRXSA-N |
| XLogP | 5.89 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.43 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|