C25H27BrN6O2 — CID 145161415
(Z)-3-bromo-1-piperidin-1-ylprop-2-en-1-one;5-(4-phenoxybenzenecarboximidoyl)pyrimidine-4,6-diamine (PubChem CID 145161415) has the molecular formula C25H27BrN6O2 and a molecular weight of 523.44 g/mol. Its IUPAC name is (Z)-3-bromo-1-piperidin-1-ylprop-2-en-1-one;5-(4-phenoxybenzenecarboximidoyl)pyrimidine-4,6-diamine.
| Compound Name | (Z)-3-bromo-1-piperidin-1-ylprop-2-en-1-one;5-(4-phenoxybenzenecarboximidoyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 145161415 |
| Molecular Formula | C25H27BrN6O2 |
| Molecular Weight | 523.44 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | (Z)-3-bromo-1-piperidin-1-ylprop-2-en-1-one;5-(4-phenoxybenzenecarboximidoyl)pyrimidine-4,6-diamine |
| SMILES | O=C(/C=C\Br)N1CCCCC1.[H]/N=C(\c1ccc(Oc2ccccc2)cc1)c1c(N)ncnc1N |
| InChI | InChI=1S/C17H15N5O.C8H12BrNO/c18-15(14-16(19)21-10-22-17(14)20)11-6-8-13(9-7-11)23-12-4-2-1-3-5-12;9-5-4-8(11)10-6-2-1-3-7-10/h1-10,18H,(H4,19,20,21,22);4-5H,1-3,6-7H2/b18-15+;5-4- |
| InChIKey | ZIXSEQWXFGOURC-QDVHOOBDSA-N |
| XLogP | 4.76 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|