C22H22N6O2 — CID 144842495
N-[2-[[6-amino-5-(4-hydroxybenzenecarboximidoyl)pyrimidin-4-yl]amino]ethyl]-N-phenylprop-2-enamide (PubChem CID 144842495) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is N-[2-[[6-amino-5-(4-hydroxybenzenecarboximidoyl)pyrimidin-4-yl]amino]ethyl]-N-phenylprop-2-enamide.
| Compound Name | N-[2-[[6-amino-5-(4-hydroxybenzenecarboximidoyl)pyrimidin-4-yl]amino]ethyl]-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 144842495 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N-[2-[[6-amino-5-(4-hydroxybenzenecarboximidoyl)pyrimidin-4-yl]amino]ethyl]-N-phenylprop-2-enamide |
| SMILES | [H]/N=C(\c1ccc(O)cc1)c1c(N)ncnc1NCCN(C(=O)C=C)c1ccccc1 |
| InChI | InChI=1S/C22H22N6O2/c1-2-18(30)28(16-6-4-3-5-7-16)13-12-25-22-19(21(24)26-14-27-22)20(23)15-8-10-17(29)11-9-15/h2-11,14,23,29H,1,12-13H2,(H3,24,25,26,27)/b23-20+ |
| InChIKey | WUDWHCIEHXSLPM-BSYVCWPDSA-N |
| XLogP | 2.81 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|