About S-(1H-indol-3-yl) carbamothioate
S-(1H-indol-3-yl) carbamothioate (PubChem CID 118129188) has the molecular formula C9H8N2OS
and a molecular weight of 192.24 g/mol. Its IUPAC name is S-(1H-indol-3-yl) carbamothioate.
Molecular Properties
| Compound Name | S-(1H-indol-3-yl) carbamothioate |
| PubChem CID | 118129188 |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | S-(1H-indol-3-yl) carbamothioate |
| SMILES | NC(=O)Sc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C9H8N2OS/c10-9(12)13-8-5-11-7-4-2-1-3-6(7)8/h1-5,11H,(H2,10,12) |
| InChIKey | COKRBQZQCWPQDF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(1H-indol-3-yl) carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(1H-indol-3-yl) carbamothioate?
The IUPAC name of S-(1H-indol-3-yl) carbamothioate (CID 118129188) is S-(1H-indol-3-yl) carbamothioate.
What is the SMILES notation for S-(1H-indol-3-yl) carbamothioate?
The canonical SMILES for S-(1H-indol-3-yl) carbamothioate is NC(=O)Sc1c[nH]c2ccccc12.
What is the InChIKey of S-(1H-indol-3-yl) carbamothioate?
The InChIKey is COKRBQZQCWPQDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2OS/c10-9(12)13-8-5-11-7-4-2-1-3-6(7)8/h1-5,11H,(H2,10,12).
What are the key properties of S-(1H-indol-3-yl) carbamothioate?
S-(1H-indol-3-yl) carbamothioate has a molecular weight of 192.24 g/mol, XLogP of 2.34, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(1H-indol-3-yl) carbamothioate is sourced from PubChem (CID 118129188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).