C17H14N4O — CID 57486091
1,1-bis(1H-indol-3-yl)urea (PubChem CID 57486091) has the molecular formula C17H14N4O and a molecular weight of 290.33 g/mol. Its IUPAC name is 1,1-bis(1H-indol-3-yl)urea.
| Compound Name | 1,1-bis(1H-indol-3-yl)urea |
|---|---|
| PubChem CID | 57486091 |
| Molecular Formula | C17H14N4O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1,1-bis(1H-indol-3-yl)urea |
| SMILES | NC(=O)N(c1c[nH]c2ccccc12)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H14N4O/c18-17(22)21(15-9-19-13-7-3-1-5-11(13)15)16-10-20-14-8-4-2-6-12(14)16/h1-10,19-20H,(H2,18,22) |
| InChIKey | NFJXTBSTHFMIRZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 77.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |