C18H34N6O — CID 143087711
4-N-cyclohexyl-5-ethanimidoylpyrimidine-4,6-diamine;ethane;morpholine (PubChem CID 143087711) has the molecular formula C18H34N6O and a molecular weight of 350.51 g/mol. Its IUPAC name is 4-N-cyclohexyl-5-ethanimidoylpyrimidine-4,6-diamine;ethane;morpholine.
| Compound Name | 4-N-cyclohexyl-5-ethanimidoylpyrimidine-4,6-diamine;ethane;morpholine |
|---|---|
| PubChem CID | 143087711 |
| Molecular Formula | C18H34N6O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | 4-N-cyclohexyl-5-ethanimidoylpyrimidine-4,6-diamine;ethane;morpholine |
| SMILES | C1COCCN1.CC.[H]/N=C(\C)c1c(N)ncnc1NC1CCCCC1 |
| InChI | InChI=1S/C12H19N5.C4H9NO.C2H6/c1-8(13)10-11(14)15-7-16-12(10)17-9-5-3-2-4-6-9;1-3-6-4-2-5-1;1-2/h7,9,13H,2-6H2,1H3,(H3,14,15,16,17);5H,1-4H2;1-2H3/b13-8+;; |
| InChIKey | IHQYPQZQMHMJMB-LIYVDSPJSA-N |
| XLogP | 2.82 |
| TPSA | 108.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|