C11H17BrN6 — CID 146520719
4-amino-6-[(1-methylpiperidin-3-yl)amino]pyrimidine-5-carboximidoyl bromide (PubChem CID 146520719) has the molecular formula C11H17BrN6 and a molecular weight of 313.20 g/mol. Its IUPAC name is 4-amino-6-[(1-methylpiperidin-3-yl)amino]pyrimidine-5-carboximidoyl bromide.
| Compound Name | 4-amino-6-[(1-methylpiperidin-3-yl)amino]pyrimidine-5-carboximidoyl bromide |
|---|---|
| PubChem CID | 146520719 |
| Molecular Formula | C11H17BrN6 |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 4-amino-6-[(1-methylpiperidin-3-yl)amino]pyrimidine-5-carboximidoyl bromide |
| SMILES | [H]/N=C(\Br)c1c(N)ncnc1NC1CCCN(C)C1 |
| InChI | InChI=1S/C11H17BrN6/c1-18-4-2-3-7(5-18)17-11-8(9(12)13)10(14)15-6-16-11/h6-7,13H,2-5H2,1H3,(H3,14,15,16,17)/b13-9- |
| InChIKey | BHUPDTMKMABXTE-LCYFTJDESA-N |
| XLogP | 1.29 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|