C23H27N6OP — CID 130319137
5-(4-cyclohepta-1,3,5-trien-1-yloxybenzenecarboximidoyl)-4-N-(1-phosphanylpiperidin-3-yl)pyrimidine-4,6-diamine (PubChem CID 130319137) has the molecular formula C23H27N6OP and a molecular weight of 434.48 g/mol. Its IUPAC name is 5-(4-cyclohepta-1,3,5-trien-1-yloxybenzenecarboximidoyl)-4-N-(1-phosphanylpiperidin-3-yl)pyrimidine-4,6-diamine.
| Compound Name | 5-(4-cyclohepta-1,3,5-trien-1-yloxybenzenecarboximidoyl)-4-N-(1-phosphanylpiperidin-3-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 130319137 |
| Molecular Formula | C23H27N6OP |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 5-(4-cyclohepta-1,3,5-trien-1-yloxybenzenecarboximidoyl)-4-N-(1-phosphanylpiperidin-3-yl)pyrimidine-4,6-diamine |
| SMILES | [H]/N=C(\c1ccc(OC2=CC=CC=CC2)cc1)c1c(N)ncnc1NC1CCCN(P)C1 |
| InChI | InChI=1S/C23H27N6OP/c24-21(16-9-11-19(12-10-16)30-18-7-3-1-2-4-8-18)20-22(25)26-15-27-23(20)28-17-6-5-13-29(31)14-17/h1-4,7,9-12,15,17,24H,5-6,8,13-14,31H2,(H3,25,26,27,28)/b24-21+ |
| InChIKey | CLDRLUGIVMPAHG-DARPEHSRSA-N |
| XLogP | 3.92 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|