C15H22ClN5O2 — CID 174277550
tert-butyl 4-(4-amino-6-chloropyrimidine-5-carboximidoyl)piperidine-1-carboxylate (PubChem CID 174277550) has the molecular formula C15H22ClN5O2 and a molecular weight of 339.83 g/mol. Its IUPAC name is tert-butyl 4-(4-amino-6-chloropyrimidine-5-carboximidoyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-amino-6-chloropyrimidine-5-carboximidoyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 174277550 |
| Molecular Formula | C15H22ClN5O2 |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | tert-butyl 4-(4-amino-6-chloropyrimidine-5-carboximidoyl)piperidine-1-carboxylate |
| SMILES | [H]/N=C(/c1c(N)ncnc1Cl)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H22ClN5O2/c1-15(2,3)23-14(22)21-6-4-9(5-7-21)11(17)10-12(16)19-8-20-13(10)18/h8-9,17H,4-7H2,1-3H3,(H2,18,19,20)/b17-11+ |
| InChIKey | HPGCTMIQXZFAMD-GZTJUZNOSA-N |
| XLogP | 2.73 |
| TPSA | 105.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|