C23H29N7O3 — CID 170191137
tert-butyl 6-[[6-amino-5-(4-formamidobenzenecarboximidoyl)pyrimidin-4-yl]amino]-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 170191137) has the molecular formula C23H29N7O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is tert-butyl 6-[[6-amino-5-(4-formamidobenzenecarboximidoyl)pyrimidin-4-yl]amino]-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-[[6-amino-5-(4-formamidobenzenecarboximidoyl)pyrimidin-4-yl]amino]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 170191137 |
| Molecular Formula | C23H29N7O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | tert-butyl 6-[[6-amino-5-(4-formamidobenzenecarboximidoyl)pyrimidin-4-yl]amino]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | [H]/N=C(\c1ccc(NC=O)cc1)c1c(N)ncnc1NC1CC2CC1N(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C23H29N7O3/c1-23(2,3)33-22(32)30-10-13-8-16(17(30)9-13)29-21-18(20(25)26-11-27-21)19(24)14-4-6-15(7-5-14)28-12-31/h4-7,11-13,16-17,24H,8-10H2,1-3H3,(H,28,31)(H3,25,26,27,29)/b24-19+ |
| InChIKey | LXSLTJQZZLZXSR-LYBHJNIJSA-N |
| XLogP | 2.85 |
| TPSA | 146.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|