C28H28F3N7O — CID 145120433
N-[3-[3-[4-amino-6-[(1-methylpyrrolidin-3-yl)methylamino]pyrimidin-5-yl]-3-iminoprop-1-ynyl]-4-methylphenyl]-3-(trifluoromethyl)benzamide (PubChem CID 145120433) has the molecular formula C28H28F3N7O and a molecular weight of 535.57 g/mol. Its IUPAC name is N-[3-[3-[4-amino-6-[(1-methylpyrrolidin-3-yl)methylamino]pyrimidin-5-yl]-3-iminoprop-1-ynyl]-4-methylphenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[3-[4-amino-6-[(1-methylpyrrolidin-3-yl)methylamino]pyrimidin-5-yl]-3-iminoprop-1-ynyl]-4-methylphenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 145120433 |
| Molecular Formula | C28H28F3N7O |
| Molecular Weight | 535.57 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | N-[3-[3-[4-amino-6-[(1-methylpyrrolidin-3-yl)methylamino]pyrimidin-5-yl]-3-iminoprop-1-ynyl]-4-methylphenyl]-3-(trifluoromethyl)benzamide |
| SMILES | [H]/N=C(\C#Cc1cc(NC(=O)c2cccc(C(F)(F)F)c2)ccc1C)c1c(N)ncnc1NCC1CCN(C)C1 |
| InChI | InChI=1S/C28H28F3N7O/c1-17-6-8-22(37-27(39)20-4-3-5-21(12-20)28(29,30)31)13-19(17)7-9-23(32)24-25(33)35-16-36-26(24)34-14-18-10-11-38(2)15-18/h3-6,8,12-13,16,18,32H,10-11,14-15H2,1-2H3,(H,37,39)(H3,33,34,35,36)/b32-23+ |
| InChIKey | ZTEUPKOZVUULLB-AWSUPERCSA-N |
| XLogP | 4.42 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|