C26H25ClF3N6O2+ — CID 145120356
[6-amino-5-[3-[5-[[4-chloro-3-(trifluoromethyl)benzoyl]amino]-2-methylphenyl]prop-2-ynimidoyl]pyrimidin-4-yl]-[(2S)-3-hydroxy-2-methylpropyl]azanium (PubChem CID 145120356) has the molecular formula C26H25ClF3N6O2+ and a molecular weight of 545.97 g/mol. Its IUPAC name is [6-amino-5-[3-[5-[[4-chloro-3-(trifluoromethyl)benzoyl]amino]-2-methylphenyl]prop-2-ynimidoyl]pyrimidin-4-yl]-[(2S)-3-hydroxy-2-methylpropyl]azanium.
| Compound Name | [6-amino-5-[3-[5-[[4-chloro-3-(trifluoromethyl)benzoyl]amino]-2-methylphenyl]prop-2-ynimidoyl]pyrimidin-4-yl]-[(2S)-3-hydroxy-2-methylpropyl]azanium |
|---|---|
| PubChem CID | 145120356 |
| Molecular Formula | C26H25ClF3N6O2+ |
| Molecular Weight | 545.97 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | [6-amino-5-[3-[5-[[4-chloro-3-(trifluoromethyl)benzoyl]amino]-2-methylphenyl]prop-2-ynimidoyl]pyrimidin-4-yl]-[(2S)-3-hydroxy-2-methylpropyl]azanium |
| SMILES | [H]/N=C(\C#Cc1cc(NC(=O)c2ccc(Cl)c(C(F)(F)F)c2)ccc1C)c1c(N)ncnc1[NH2+]C[C@H](C)CO |
| InChI | InChI=1S/C26H24ClF3N6O2/c1-14(12-37)11-33-24-22(23(32)34-13-35-24)21(31)8-5-16-9-18(6-3-15(16)2)36-25(38)17-4-7-20(27)19(10-17)26(28,29)30/h3-4,6-7,9-10,13-14,31,37H,11-12H2,1-2H3,(H,36,38)(H3,32,33,34,35)/p+1/b31-21+/t14-/m0/s1 |
| InChIKey | XOVXBTVQRFEZLU-PISBBOGYSA-O |
| XLogP | 3.53 |
| TPSA | 141.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.97 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|