C31H34F4N6O — CID 145120432
N-[3-[3-[4-amino-6-(nonan-4-ylamino)pyrimidin-5-yl]-3-iminoprop-1-ynyl]-4-methylphenyl]-2-fluoro-5-(trifluoromethyl)benzamide (PubChem CID 145120432) has the molecular formula C31H34F4N6O and a molecular weight of 582.65 g/mol. Its IUPAC name is N-[3-[3-[4-amino-6-(nonan-4-ylamino)pyrimidin-5-yl]-3-iminoprop-1-ynyl]-4-methylphenyl]-2-fluoro-5-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[3-[4-amino-6-(nonan-4-ylamino)pyrimidin-5-yl]-3-iminoprop-1-ynyl]-4-methylphenyl]-2-fluoro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 145120432 |
| Molecular Formula | C31H34F4N6O |
| Molecular Weight | 582.65 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | N-[3-[3-[4-amino-6-(nonan-4-ylamino)pyrimidin-5-yl]-3-iminoprop-1-ynyl]-4-methylphenyl]-2-fluoro-5-(trifluoromethyl)benzamide |
| SMILES | [H]/N=C(\C#Cc1cc(NC(=O)c2cc(C(F)(F)F)ccc2F)ccc1C)c1c(N)ncnc1NC(CCC)CCCCC |
| InChI | InChI=1S/C31H34F4N6O/c1-4-6-7-9-22(8-5-2)40-29-27(28(37)38-18-39-29)26(36)15-11-20-16-23(13-10-19(20)3)41-30(42)24-17-21(31(33,34)35)12-14-25(24)32/h10,12-14,16-18,22,36H,4-9H2,1-3H3,(H,41,42)(H3,37,38,39,40)/b36-26+ |
| InChIKey | BWPGMFSFYYAHCO-LZBRRTOVSA-N |
| XLogP | 7.36 |
| TPSA | 116.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.65 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|