C19H19F3N2OSi — CID 164572625
N-[4-methyl-3-(2-trimethylsilylethynyl)phenyl]-4-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 164572625) has the molecular formula C19H19F3N2OSi and a molecular weight of 376.45 g/mol. Its IUPAC name is N-[4-methyl-3-(2-trimethylsilylethynyl)phenyl]-4-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[4-methyl-3-(2-trimethylsilylethynyl)phenyl]-4-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 164572625 |
| Molecular Formula | C19H19F3N2OSi |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-[4-methyl-3-(2-trimethylsilylethynyl)phenyl]-4-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(C(F)(F)F)ccn2)cc1C#C[Si](C)(C)C |
| InChI | InChI=1S/C19H19F3N2OSi/c1-13-5-6-16(11-14(13)8-10-26(2,3)4)24-18(25)17-12-15(7-9-23-17)19(20,21)22/h5-7,9,11-12H,1-4H3,(H,24,25) |
| InChIKey | SYTUTMHHKRIKGW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|