C27H30F3N7O — CID 145120569
6-N-methyl-5-[3-[2-methyl-5-(methylamino)phenyl]prop-2-ynimidoyl]-4-N-propan-2-ylpyrimidine-4,6-diamine;N-[3-(trifluoromethyl)phenyl]formamide (PubChem CID 145120569) has the molecular formula C27H30F3N7O and a molecular weight of 525.58 g/mol. Its IUPAC name is 6-N-methyl-5-[3-[2-methyl-5-(methylamino)phenyl]prop-2-ynimidoyl]-4-N-propan-2-ylpyrimidine-4,6-diamine;N-[3-(trifluoromethyl)phenyl]formamide.
| Compound Name | 6-N-methyl-5-[3-[2-methyl-5-(methylamino)phenyl]prop-2-ynimidoyl]-4-N-propan-2-ylpyrimidine-4,6-diamine;N-[3-(trifluoromethyl)phenyl]formamide |
|---|---|
| PubChem CID | 145120569 |
| Molecular Formula | C27H30F3N7O |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | 6-N-methyl-5-[3-[2-methyl-5-(methylamino)phenyl]prop-2-ynimidoyl]-4-N-propan-2-ylpyrimidine-4,6-diamine;N-[3-(trifluoromethyl)phenyl]formamide |
| SMILES | O=CNc1cccc(C(F)(F)F)c1.[H]/N=C(\C#Cc1cc(NC)ccc1C)c1c(NC)ncnc1NC(C)C |
| InChI | InChI=1S/C19H24N6.C8H6F3NO/c1-12(2)25-19-17(18(22-5)23-11-24-19)16(20)9-7-14-10-15(21-4)8-6-13(14)3;9-8(10,11)6-2-1-3-7(4-6)12-5-13/h6,8,10-12,20-21H,1-5H3,(H2,22,23,24,25);1-5H,(H,12,13)/b20-16+; |
| InChIKey | KSZTZWQTIGWMEP-QTNJPTFUSA-N |
| XLogP | 5.38 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|