C21H26Cl2F3N3 — CID 23468673
[4-(3-phenylpropyl)piperazin-1-yl]-[3-(trifluoromethyl)phenyl]methanimine;dihydrochloride (PubChem CID 23468673) has the molecular formula C21H26Cl2F3N3 and a molecular weight of 448.36 g/mol. Its IUPAC name is [4-(3-phenylpropyl)piperazin-1-yl]-[3-(trifluoromethyl)phenyl]methanimine;dihydrochloride.
| Compound Name | [4-(3-phenylpropyl)piperazin-1-yl]-[3-(trifluoromethyl)phenyl]methanimine;dihydrochloride |
|---|---|
| PubChem CID | 23468673 |
| Molecular Formula | C21H26Cl2F3N3 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | [4-(3-phenylpropyl)piperazin-1-yl]-[3-(trifluoromethyl)phenyl]methanimine;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(/c1cccc(C(F)(F)F)c1)N1CCN(CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H24F3N3.2ClH/c22-21(23,24)19-10-4-9-18(16-19)20(25)27-14-12-26(13-15-27)11-5-8-17-6-2-1-3-7-17;;/h1-4,6-7,9-10,16,25H,5,8,11-15H2;2*1H/b25-20-;; |
| InChIKey | NMWLXFSZFRXXTD-ZYCAJPBPSA-N |
| XLogP | 5.12 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|