C24H28F3N3 — CID 170864386
3-[3-(4-methylpiperazin-1-yl)propyl]-1-[[3-(trifluoromethyl)phenyl]methyl]indole (PubChem CID 170864386) has the molecular formula C24H28F3N3 and a molecular weight of 415.50 g/mol. Its IUPAC name is 3-[3-(4-methylpiperazin-1-yl)propyl]-1-[[3-(trifluoromethyl)phenyl]methyl]indole.
| Compound Name | 3-[3-(4-methylpiperazin-1-yl)propyl]-1-[[3-(trifluoromethyl)phenyl]methyl]indole |
|---|---|
| PubChem CID | 170864386 |
| Molecular Formula | C24H28F3N3 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 3-[3-(4-methylpiperazin-1-yl)propyl]-1-[[3-(trifluoromethyl)phenyl]methyl]indole |
| SMILES | CN1CCN(CCCc2cn(Cc3cccc(C(F)(F)F)c3)c3ccccc23)CC1 |
| InChI | InChI=1S/C24H28F3N3/c1-28-12-14-29(15-13-28)11-5-7-20-18-30(23-10-3-2-9-22(20)23)17-19-6-4-8-21(16-19)24(25,26)27/h2-4,6,8-10,16,18H,5,7,11-15,17H2,1H3 |
| InChIKey | MPKXDVCXNSOCRK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |